C21H27N5O7S — CID 18261415
2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]pentanedioic acid (PubChem CID 18261415) has the molecular formula C21H27N5O7S and a molecular weight of 493.54 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18261415 |
| Molecular Formula | C21H27N5O7S |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]pentanedioic acid |
| SMILES | NC(CS)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NCC(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C21H27N5O7S/c22-13(10-34)19(30)26-16(7-11-8-23-14-4-2-1-3-12(11)14)20(31)24-9-17(27)25-15(21(32)33)5-6-18(28)29/h1-4,8,13,15-16,23,34H,5-7,9-10,22H2,(H,24,31)(H,25,27)(H,26,30)(H,28,29)(H,32,33) |
| InChIKey | KLDGWIXAEWJMES-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 203.71 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|