C22H28N6O8 — CID 19942991
2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]acetyl]amino]pentanedioic acid (PubChem CID 19942991) has the molecular formula C22H28N6O8 and a molecular weight of 504.50 g/mol. Its IUPAC name is 2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]acetyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]acetyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 19942991 |
| Molecular Formula | C22H28N6O8 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | 2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]acetyl]amino]pentanedioic acid |
| SMILES | NC(=O)CC(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NCC(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H28N6O8/c23-13(7-11-9-25-14-4-2-1-3-12(11)14)20(33)28-16(8-17(24)29)21(34)26-10-18(30)27-15(22(35)36)5-6-19(31)32/h1-4,9,13,15-16,25H,5-8,10,23H2,(H2,24,29)(H,26,34)(H,27,30)(H,28,33)(H,31,32)(H,35,36) |
| InChIKey | LXMINQOWXVZUAT-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 246.80 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |