C24H31N7O9 — CID 19942912
5-amino-2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-3-carboxypropanoyl]amino]-5-oxopentanoic acid (PubChem CID 19942912) has the molecular formula C24H31N7O9 and a molecular weight of 561.55 g/mol. Its IUPAC name is 5-amino-2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-3-carboxypropanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-3-carboxypropanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 19942912 |
| Molecular Formula | C24H31N7O9 |
| Molecular Weight | 561.55 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | 5-amino-2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-3-carboxypropanoyl]amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)C(CC(=O)O)NC(=O)C(CC(N)=O)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C24H31N7O9/c25-13(7-11-10-28-14-4-2-1-3-12(11)14)21(36)30-16(8-19(27)33)22(37)31-17(9-20(34)35)23(38)29-15(24(39)40)5-6-18(26)32/h1-4,10,13,15-17,28H,5-9,25H2,(H2,26,32)(H2,27,33)(H,29,38)(H,30,36)(H,31,37)(H,34,35)(H,39,40) |
| InChIKey | UMDNEVVCNKFHCE-UHFFFAOYSA-N |
| XLogP | -2.81 |
| TPSA | 289.89 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.55 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |