C25H33N7O9 — CID 19944510
5-amino-2-[[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-carboxypropanoyl]amino]-5-oxopentanoic acid (PubChem CID 19944510) has the molecular formula C25H33N7O9 and a molecular weight of 575.58 g/mol. Its IUPAC name is 5-amino-2-[[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-carboxypropanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-carboxypropanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 19944510 |
| Molecular Formula | C25H33N7O9 |
| Molecular Weight | 575.58 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | 5-amino-2-[[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-carboxypropanoyl]amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)C(CC(=O)O)NC(=O)C(CCC(N)=O)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C25H33N7O9/c26-14(9-12-11-29-15-4-2-1-3-13(12)15)22(37)30-16(5-7-19(27)33)23(38)32-18(10-21(35)36)24(39)31-17(25(40)41)6-8-20(28)34/h1-4,11,14,16-18,29H,5-10,26H2,(H2,27,33)(H2,28,34)(H,30,37)(H,31,39)(H,32,38)(H,35,36)(H,40,41) |
| InChIKey | MHGYHGBGXOJLAB-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 289.89 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.58 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |