C24H32N6O8 — CID 19944449
2-[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]propanoylamino]pentanedioic acid (PubChem CID 19944449) has the molecular formula C24H32N6O8 and a molecular weight of 532.55 g/mol. Its IUPAC name is 2-[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]propanoylamino]pentanedioic acid.
| Compound Name | 2-[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]propanoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 19944449 |
| Molecular Formula | C24H32N6O8 |
| Molecular Weight | 532.55 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | 2-[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]propanoylamino]pentanedioic acid |
| SMILES | CC(NC(=O)C(CCC(N)=O)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C24H32N6O8/c1-12(21(34)30-18(24(37)38)7-9-20(32)33)28-23(36)17(6-8-19(26)31)29-22(35)15(25)10-13-11-27-16-5-3-2-4-14(13)16/h2-5,11-12,15,17-18,27H,6-10,25H2,1H3,(H2,26,31)(H,28,36)(H,29,35)(H,30,34)(H,32,33)(H,37,38) |
| InChIKey | PHNJTTPLKRRMCT-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 246.80 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.55 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |