C25H34N6O9 — CID 19944370
5-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-carboxybutanoyl]amino]-3-hydroxybutanoyl]amino]-5-oxopentanoic acid (PubChem CID 19944370) has the molecular formula C25H34N6O9 and a molecular weight of 562.58 g/mol. Its IUPAC name is 5-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-carboxybutanoyl]amino]-3-hydroxybutanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-carboxybutanoyl]amino]-3-hydroxybutanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 19944370 |
| Molecular Formula | C25H34N6O9 |
| Molecular Weight | 562.58 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | 5-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-carboxybutanoyl]amino]-3-hydroxybutanoyl]amino]-5-oxopentanoic acid |
| SMILES | CC(O)C(NC(=O)C(CCC(=O)O)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C25H34N6O9/c1-12(32)21(24(38)30-18(25(39)40)6-8-19(27)33)31-23(37)17(7-9-20(34)35)29-22(36)15(26)10-13-11-28-16-5-3-2-4-14(13)16/h2-5,11-12,15,17-18,21,28,32H,6-10,26H2,1H3,(H2,27,33)(H,29,36)(H,30,38)(H,31,37)(H,34,35)(H,39,40) |
| InChIKey | VUTUSQPIVFRDEI-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 267.03 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.58 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |