C25H35N5O8S — CID 19948666
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-4-methylsulfanylbutanoyl]amino]pentanedioic acid (PubChem CID 19948666) has the molecular formula C25H35N5O8S and a molecular weight of 565.65 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-4-methylsulfanylbutanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-4-methylsulfanylbutanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 19948666 |
| Molecular Formula | C25H35N5O8S |
| Molecular Weight | 565.65 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-4-methylsulfanylbutanoyl]amino]pentanedioic acid |
| SMILES | CSCCC(NC(=O)C(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(C)O)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C25H35N5O8S/c1-13(31)21(30-22(34)16(26)11-14-12-27-17-6-4-3-5-15(14)17)24(36)28-18(9-10-39-2)23(35)29-19(25(37)38)7-8-20(32)33/h3-6,12-13,16,18-19,21,27,31H,7-11,26H2,1-2H3,(H,28,36)(H,29,35)(H,30,34)(H,32,33)(H,37,38) |
| InChIKey | VZUJZZPVKWBMJO-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 223.94 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.65 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |