C31H36N6O8 — CID 19948538
4-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-5-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-5-oxopentanoic acid (PubChem CID 19948538) has the molecular formula C31H36N6O8 and a molecular weight of 620.66 g/mol. Its IUPAC name is 4-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-5-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-5-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 19948538 |
| Molecular Formula | C31H36N6O8 |
| Molecular Weight | 620.66 g/mol |
| Exact Mass | 620.26 |
| IUPAC Name | 4-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-5-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-5-oxopentanoic acid |
| SMILES | CC(O)C(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C31H36N6O8/c1-16(38)27(37-28(41)21(32)12-17-14-33-22-8-4-2-6-19(17)22)30(43)35-24(10-11-26(39)40)29(42)36-25(31(44)45)13-18-15-34-23-9-5-3-7-20(18)23/h2-9,14-16,21,24-25,27,33-34,38H,10-13,32H2,1H3,(H,35,43)(H,36,42)(H,37,41)(H,39,40)(H,44,45) |
| InChIKey | NHYHEAWWTUDPGX-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 239.73 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.66 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |