C23H31N5O8 — CID 19942168
4-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]-5-[(1-carboxy-2-hydroxypropyl)amino]-5-oxopentanoic acid (PubChem CID 19942168) has the molecular formula C23H31N5O8 and a molecular weight of 505.53 g/mol. Its IUPAC name is 4-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]-5-[(1-carboxy-2-hydroxypropyl)amino]-5-oxopentanoic acid.
| Compound Name | 4-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]-5-[(1-carboxy-2-hydroxypropyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 19942168 |
| Molecular Formula | C23H31N5O8 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 4-[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]propanoylamino]-5-[(1-carboxy-2-hydroxypropyl)amino]-5-oxopentanoic acid |
| SMILES | CC(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CCC(=O)O)C(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C23H31N5O8/c1-11(26-21(33)15(24)9-13-10-25-16-6-4-3-5-14(13)16)20(32)27-17(7-8-18(30)31)22(34)28-19(12(2)29)23(35)36/h3-6,10-12,15,17,19,25,29H,7-9,24H2,1-2H3,(H,26,33)(H,27,32)(H,28,34)(H,30,31)(H,35,36) |
| InChIKey | XVTBJRDXSWNXAT-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 223.94 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |