C24H31N5O10 — CID 19944122
4-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-[[3-carboxy-1-[(1-carboxy-2-hydroxypropyl)amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 19944122) has the molecular formula C24H31N5O10 and a molecular weight of 549.54 g/mol. Its IUPAC name is 4-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-[[3-carboxy-1-[(1-carboxy-2-hydroxypropyl)amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-[[3-carboxy-1-[(1-carboxy-2-hydroxypropyl)amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 19944122 |
| Molecular Formula | C24H31N5O10 |
| Molecular Weight | 549.54 g/mol |
| Exact Mass | 549.21 |
| IUPAC Name | 4-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-[[3-carboxy-1-[(1-carboxy-2-hydroxypropyl)amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CC(O)C(NC(=O)C(CC(=O)O)NC(=O)C(CCC(=O)O)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C24H31N5O10/c1-11(30)20(24(38)39)29-23(37)17(9-19(33)34)28-22(36)16(6-7-18(31)32)27-21(35)14(25)8-12-10-26-15-5-3-2-4-13(12)15/h2-5,10-11,14,16-17,20,26,30H,6-9,25H2,1H3,(H,27,35)(H,28,36)(H,29,37)(H,31,32)(H,33,34)(H,38,39) |
| InChIKey | MGAWRSFOPCPOPG-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 261.24 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.54 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |