C23H31N5O9 — CID 19948497
3-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-4-[(1-carboxy-2-hydroxypropyl)amino]-4-oxobutanoic acid (PubChem CID 19948497) has the molecular formula C23H31N5O9 and a molecular weight of 521.53 g/mol. Its IUPAC name is 3-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-4-[(1-carboxy-2-hydroxypropyl)amino]-4-oxobutanoic acid.
| Compound Name | 3-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-4-[(1-carboxy-2-hydroxypropyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 19948497 |
| Molecular Formula | C23H31N5O9 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | 3-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-4-[(1-carboxy-2-hydroxypropyl)amino]-4-oxobutanoic acid |
| SMILES | CC(O)C(NC(=O)C(CC(=O)O)NC(=O)C(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(C)O)C(=O)O |
| InChI | InChI=1S/C23H31N5O9/c1-10(29)18(27-20(33)14(24)7-12-9-25-15-6-4-3-5-13(12)15)22(35)26-16(8-17(31)32)21(34)28-19(11(2)30)23(36)37/h3-6,9-11,14,16,18-19,25,29-30H,7-8,24H2,1-2H3,(H,26,35)(H,27,33)(H,28,34)(H,31,32)(H,36,37) |
| InChIKey | GRADHGDCZBUVCV-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 244.17 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |