C22H29N5O9 — CID 19948724
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid (PubChem CID 19948724) has the molecular formula C22H29N5O9 and a molecular weight of 507.50 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 19948724 |
| Molecular Formula | C22H29N5O9 |
| Molecular Weight | 507.50 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid |
| SMILES | CC(O)C(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CO)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H29N5O9/c1-10(29)18(21(34)26-16(9-28)20(33)25-15(22(35)36)7-17(30)31)27-19(32)13(23)6-11-8-24-14-5-3-2-4-12(11)14/h2-5,8,10,13,15-16,18,24,28-29H,6-7,9,23H2,1H3,(H,25,33)(H,26,34)(H,27,32)(H,30,31)(H,35,36) |
| InChIKey | YMMGHQWSGKAVNI-UHFFFAOYSA-N |
| XLogP | -2.58 |
| TPSA | 244.17 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.50 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |