C22H27N5O10 — CID 19948085
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]-3-carboxypropanoyl]amino]butanedioic acid (PubChem CID 19948085) has the molecular formula C22H27N5O10 and a molecular weight of 521.48 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]-3-carboxypropanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]-3-carboxypropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 19948085 |
| Molecular Formula | C22H27N5O10 |
| Molecular Weight | 521.48 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]-3-carboxypropanoyl]amino]butanedioic acid |
| SMILES | NC(Cc1c[nH]c2ccccc12)C(=O)NC(CO)C(=O)NC(CC(=O)O)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H27N5O10/c23-12(5-10-8-24-13-4-2-1-3-11(10)13)19(33)27-16(9-28)21(35)25-14(6-17(29)30)20(34)26-15(22(36)37)7-18(31)32/h1-4,8,12,14-16,24,28H,5-7,9,23H2,(H,25,35)(H,26,34)(H,27,33)(H,29,30)(H,31,32)(H,36,37) |
| InChIKey | UYOALPSSUXOBDJ-UHFFFAOYSA-N |
| XLogP | -2.48 |
| TPSA | 261.24 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.48 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |