C21H27N5O8S — CID 18260813
2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-hydroxypropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid (PubChem CID 18260813) has the molecular formula C21H27N5O8S and a molecular weight of 509.54 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-hydroxypropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-hydroxypropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18260813 |
| Molecular Formula | C21H27N5O8S |
| Molecular Weight | 509.54 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-hydroxypropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid |
| SMILES | NC(CS)C(=O)NC(CO)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C21H27N5O8S/c22-12(9-35)18(30)26-16(8-27)20(32)24-14(19(31)25-15(21(33)34)6-17(28)29)5-10-7-23-13-4-2-1-3-11(10)13/h1-4,7,12,14-16,23,27,35H,5-6,8-9,22H2,(H,24,32)(H,25,31)(H,26,30)(H,28,29)(H,33,34) |
| InChIKey | MCESTEGDHZNYNW-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 223.94 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.54 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|