C22H27N5O9S — CID 18255760
3-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-carboxypropanoyl]amino]-4-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-4-oxobutanoic acid (PubChem CID 18255760) has the molecular formula C22H27N5O9S and a molecular weight of 537.55 g/mol. Its IUPAC name is 3-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-carboxypropanoyl]amino]-4-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-carboxypropanoyl]amino]-4-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18255760 |
| Molecular Formula | C22H27N5O9S |
| Molecular Weight | 537.55 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | 3-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-carboxypropanoyl]amino]-4-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-4-oxobutanoic acid |
| SMILES | NC(CS)C(=O)NC(CC(=O)O)C(=O)NC(CC(=O)O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C22H27N5O9S/c23-12(9-37)19(32)25-14(6-17(28)29)20(33)26-15(7-18(30)31)21(34)27-16(22(35)36)5-10-8-24-13-4-2-1-3-11(10)13/h1-4,8,12,14-16,24,37H,5-7,9,23H2,(H,25,32)(H,26,33)(H,27,34)(H,28,29)(H,30,31)(H,35,36) |
| InChIKey | GHYUVVQJNVRMKJ-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 241.01 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.55 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|