C21H27N5O7S — CID 18254563
3-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]-4-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-4-oxobutanoic acid (PubChem CID 18254563) has the molecular formula C21H27N5O7S and a molecular weight of 493.54 g/mol. Its IUPAC name is 3-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]-4-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]-4-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18254563 |
| Molecular Formula | C21H27N5O7S |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 3-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]-4-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-4-oxobutanoic acid |
| SMILES | CC(NC(=O)C(N)CS)C(=O)NC(CC(=O)O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C21H27N5O7S/c1-10(24-19(30)13(22)9-34)18(29)25-15(7-17(27)28)20(31)26-16(21(32)33)6-11-8-23-14-5-3-2-4-12(11)14/h2-5,8,10,13,15-16,23,34H,6-7,9,22H2,1H3,(H,24,30)(H,25,29)(H,26,31)(H,27,28)(H,32,33) |
| InChIKey | ZEERVBGDPODWJP-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 203.71 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|