C20H27N5O6S — CID 18260488
2-[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-hydroxypropanoyl]amino]propanoylamino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18260488) has the molecular formula C20H27N5O6S and a molecular weight of 465.53 g/mol. Its IUPAC name is 2-[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-hydroxypropanoyl]amino]propanoylamino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-hydroxypropanoyl]amino]propanoylamino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18260488 |
| Molecular Formula | C20H27N5O6S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 2-[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-hydroxypropanoyl]amino]propanoylamino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC(NC(=O)C(CO)NC(=O)C(N)CS)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C20H27N5O6S/c1-10(23-19(29)16(8-26)25-18(28)13(21)9-32)17(27)24-15(20(30)31)6-11-7-22-14-5-3-2-4-12(11)14/h2-5,7,10,13,15-16,22,26,32H,6,8-9,21H2,1H3,(H,23,29)(H,24,27)(H,25,28)(H,30,31) |
| InChIKey | OVIKZVGXCFRBGA-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 186.64 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|