C26H31N5O5S — CID 18254838
2-[[2-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18254838) has the molecular formula C26H31N5O5S and a molecular weight of 525.63 g/mol. Its IUPAC name is 2-[[2-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18254838 |
| Molecular Formula | C26H31N5O5S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | 2-[[2-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(NC(=O)C(N)CS)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C26H31N5O5S/c1-15(29-24(33)19(27)14-37)23(32)30-21(12-17-13-28-20-10-6-5-9-18(17)20)25(34)31-22(26(35)36)11-16-7-3-2-4-8-16/h2-10,13,15,19,21-22,28,37H,11-12,14,27H2,1H3,(H,29,33)(H,30,32)(H,31,34)(H,35,36) |
| InChIKey | OTOMRDCHJMHXIR-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 166.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|