C26H31N5O6 — CID 18742319
2-[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-phenylpropanoyl]amino]propanoylamino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18742319) has the molecular formula C26H31N5O6 and a molecular weight of 509.56 g/mol. Its IUPAC name is 2-[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-phenylpropanoyl]amino]propanoylamino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-phenylpropanoyl]amino]propanoylamino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18742319 |
| Molecular Formula | C26H31N5O6 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | 2-[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-phenylpropanoyl]amino]propanoylamino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC(NC(=O)C(Cc1ccccc1)NC(=O)C(N)CO)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C26H31N5O6/c1-15(23(33)31-22(26(36)37)12-17-13-28-20-10-6-5-9-18(17)20)29-25(35)21(30-24(34)19(27)14-32)11-16-7-3-2-4-8-16/h2-10,13,15,19,21-22,28,32H,11-12,14,27H2,1H3,(H,29,35)(H,30,34)(H,31,33)(H,36,37) |
| InChIKey | JCBZMRVIMHZRMS-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 186.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |