C24H33N5O8 — CID 18300675
2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-hydroxypropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid (PubChem CID 18300675) has the molecular formula C24H33N5O8 and a molecular weight of 519.56 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-hydroxypropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-hydroxypropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18300675 |
| Molecular Formula | C24H33N5O8 |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-hydroxypropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid |
| SMILES | CC(C)CC(N)C(=O)NC(CO)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C24H33N5O8/c1-12(2)7-15(25)21(33)29-19(11-30)23(35)27-17(22(34)28-18(24(36)37)9-20(31)32)8-13-10-26-16-6-4-3-5-14(13)16/h3-6,10,12,15,17-19,26,30H,7-9,11,25H2,1-2H3,(H,27,35)(H,28,34)(H,29,33)(H,31,32)(H,36,37) |
| InChIKey | LGCLYXDRFZFYAR-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 223.94 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |