C25H35N5O8 — CID 18301436
2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]pentanedioic acid (PubChem CID 18301436) has the molecular formula C25H35N5O8 and a molecular weight of 533.58 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18301436 |
| Molecular Formula | C25H35N5O8 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]pentanedioic acid |
| SMILES | CC(C)CC(N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CO)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C25H35N5O8/c1-13(2)9-16(26)22(34)29-19(10-14-11-27-17-6-4-3-5-15(14)17)23(35)30-20(12-31)24(36)28-18(25(37)38)7-8-21(32)33/h3-6,11,13,16,18-20,27,31H,7-10,12,26H2,1-2H3,(H,28,36)(H,29,34)(H,30,35)(H,32,33)(H,37,38) |
| InChIKey | NRRQVSPXBMNVHR-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 223.94 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |