C23H32N6O8 — CID 19948347
5-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxybutanoyl]amino]-5-oxopentanoic acid (PubChem CID 19948347) has the molecular formula C23H32N6O8 and a molecular weight of 520.54 g/mol. Its IUPAC name is 5-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxybutanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxybutanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 19948347 |
| Molecular Formula | C23H32N6O8 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | 5-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxybutanoyl]amino]-5-oxopentanoic acid |
| SMILES | CC(O)C(NC(=O)C(CO)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C23H32N6O8/c1-11(31)19(22(35)27-16(23(36)37)6-7-18(25)32)29-21(34)17(10-30)28-20(33)14(24)8-12-9-26-15-5-3-2-4-13(12)15/h2-5,9,11,14,16-17,19,26,30-31H,6-8,10,24H2,1H3,(H2,25,32)(H,27,35)(H,28,33)(H,29,34)(H,36,37) |
| InChIKey | HDJVNAADKODDMM-UHFFFAOYSA-N |
| XLogP | -2.78 |
| TPSA | 249.96 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |