C25H36N6O8 — CID 19943482
4-[[6-amino-1-[(1-carboxy-2-hydroxypropyl)amino]-1-oxohexan-2-yl]amino]-3-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoic acid (PubChem CID 19943482) has the molecular formula C25H36N6O8 and a molecular weight of 548.60 g/mol. Its IUPAC name is 4-[[6-amino-1-[(1-carboxy-2-hydroxypropyl)amino]-1-oxohexan-2-yl]amino]-3-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[6-amino-1-[(1-carboxy-2-hydroxypropyl)amino]-1-oxohexan-2-yl]amino]-3-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 19943482 |
| Molecular Formula | C25H36N6O8 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | 4-[[6-amino-1-[(1-carboxy-2-hydroxypropyl)amino]-1-oxohexan-2-yl]amino]-3-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoic acid |
| SMILES | CC(O)C(NC(=O)C(CCCCN)NC(=O)C(CC(=O)O)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C25H36N6O8/c1-13(32)21(25(38)39)31-23(36)18(8-4-5-9-26)29-24(37)19(11-20(33)34)30-22(35)16(27)10-14-12-28-17-7-3-2-6-15(14)17/h2-3,6-7,12-13,16,18-19,21,28,32H,4-5,8-11,26-27H2,1H3,(H,29,37)(H,30,35)(H,31,36)(H,33,34)(H,38,39) |
| InChIKey | BTMUFAZLHGTVBH-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 249.96 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|