C25H37N7O7 — CID 19943082
2-[[6-amino-2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]hexanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 19943082) has the molecular formula C25H37N7O7 and a molecular weight of 547.61 g/mol. Its IUPAC name is 2-[[6-amino-2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]hexanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[6-amino-2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]hexanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 19943082 |
| Molecular Formula | C25H37N7O7 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | 2-[[6-amino-2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]hexanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NC(=O)C(CCCCN)NC(=O)C(CC(N)=O)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C25H37N7O7/c1-13(33)21(25(38)39)32-23(36)18(8-4-5-9-26)30-24(37)19(11-20(28)34)31-22(35)16(27)10-14-12-29-17-7-3-2-6-15(14)17/h2-3,6-7,12-13,16,18-19,21,29,33H,4-5,8-11,26-27H2,1H3,(H2,28,34)(H,30,37)(H,31,35)(H,32,36)(H,38,39) |
| InChIKey | QCAUYHABFDYPAQ-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 255.75 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|