C24H35N7O7 — CID 19946489
2-[[4-amino-2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-4-oxobutanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 19946489) has the molecular formula C24H35N7O7 and a molecular weight of 533.59 g/mol. Its IUPAC name is 2-[[4-amino-2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-4-oxobutanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[4-amino-2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-4-oxobutanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 19946489 |
| Molecular Formula | C24H35N7O7 |
| Molecular Weight | 533.59 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | 2-[[4-amino-2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-4-oxobutanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | NCCCCC(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CC(N)=O)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C24H35N7O7/c25-8-4-3-7-17(22(35)30-18(10-20(27)33)23(36)31-19(12-32)24(37)38)29-21(34)15(26)9-13-11-28-16-6-2-1-5-14(13)16/h1-2,5-6,11,15,17-19,28,32H,3-4,7-10,12,25-26H2,(H2,27,33)(H,29,34)(H,30,35)(H,31,36)(H,37,38) |
| InChIKey | QPSQYWMQOKJAEY-UHFFFAOYSA-N |
| XLogP | -2.43 |
| TPSA | 255.75 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.59 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|