C27H42N8O6 — CID 18306719
2-[[4-amino-2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18306719) has the molecular formula C27H42N8O6 and a molecular weight of 574.68 g/mol. Its IUPAC name is 2-[[4-amino-2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[4-amino-2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18306719 |
| Molecular Formula | C27H42N8O6 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.32 |
| IUPAC Name | 2-[[4-amino-2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(CCCCN)C(=O)NC(CC(N)=O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C27H42N8O6/c28-11-5-3-8-18(30)24(37)33-20(10-4-6-12-29)25(38)34-21(14-23(31)36)26(39)35-22(27(40)41)13-16-15-32-19-9-2-1-7-17(16)19/h1-2,7,9,15,18,20-22,32H,3-6,8,10-14,28-30H2,(H2,31,36)(H,33,37)(H,34,38)(H,35,39)(H,40,41) |
| InChIKey | YMWGJMANHFPTTD-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 261.54 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|