C17H24N4O3 — CID 14275203
2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoic acid (PubChem CID 14275203) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 14275203 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C17H24N4O3/c18-8-4-3-6-13(19)16(22)21-15(17(23)24)9-11-10-20-14-7-2-1-5-12(11)14/h1-2,5,7,10,13,15,20H,3-4,6,8-9,18-19H2,(H,21,22)(H,23,24) |
| InChIKey | RVKIPWVMZANZLI-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 134.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|