C26H41N7O6 — CID 18306969
2-[[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-3-hydroxypropanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18306969) has the molecular formula C26H41N7O6 and a molecular weight of 547.66 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-3-hydroxypropanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-3-hydroxypropanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18306969 |
| Molecular Formula | C26H41N7O6 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.31 |
| IUPAC Name | 2-[[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-3-hydroxypropanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(CCCCN)C(=O)NC(CO)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C26H41N7O6/c27-11-5-3-8-18(29)23(35)31-20(10-4-6-12-28)24(36)33-22(15-34)25(37)32-21(26(38)39)13-16-14-30-19-9-2-1-7-17(16)19/h1-2,7,9,14,18,20-22,30,34H,3-6,8,10-13,15,27-29H2,(H,31,35)(H,32,37)(H,33,36)(H,38,39) |
| InChIKey | YTMBMEKMIXENBL-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 238.68 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|