C23H36N6O4 — CID 10276355
(2S)-2-[[(2S)-6-amino-2-[[(2S)-2,6-diaminohexanoyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 10276355) has the molecular formula C23H36N6O4 and a molecular weight of 460.58 g/mol. Its IUPAC name is (2S)-2-[[(2S)-6-amino-2-[[(2S)-2,6-diaminohexanoyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-[[(2S)-6-amino-2-[[(2S)-2,6-diaminohexanoyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 10276355 |
| Molecular Formula | C23H36N6O4 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | (2S)-2-[[(2S)-6-amino-2-[[(2S)-2,6-diaminohexanoyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@@H](N)CCCCN)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C23H36N6O4/c24-11-5-3-8-17(26)21(30)28-19(10-4-6-12-25)22(31)29-20(23(32)33)13-15-14-27-18-9-2-1-7-16(15)18/h1-2,7,9,14,17,19-20,27H,3-6,8,10-13,24-26H2,(H,28,30)(H,29,31)(H,32,33)/t17-,19-,20-/m0/s1 |
| InChIKey | BEGQVWUZFXLNHZ-IHPCNDPISA-N |
| XLogP | 0.35 |
| TPSA | 189.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|