C22H33N5O4S — CID 145457007
(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 145457007) has the molecular formula C22H33N5O4S and a molecular weight of 463.60 g/mol. Its IUPAC name is (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 145457007 |
| Molecular Formula | C22H33N5O4S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CSCC[C@H](N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C22H33N5O4S/c1-32-11-9-16(24)20(28)26-18(8-4-5-10-23)21(29)27-19(22(30)31)12-14-13-25-17-7-3-2-6-15(14)17/h2-3,6-7,13,16,18-19,25H,4-5,8-12,23-24H2,1H3,(H,26,28)(H,27,29)(H,30,31)/t16-,18-,19-/m0/s1 |
| InChIKey | DJJBHQHOZLUBCN-WDSOQIARSA-N |
| XLogP | 0.97 |
| TPSA | 163.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|