C27H41N7O6S — CID 19998265
5-amino-2-[[2-[[6-amino-2-[(2-amino-4-methylsulfanylbutanoyl)amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoic acid (PubChem CID 19998265) has the molecular formula C27H41N7O6S and a molecular weight of 591.74 g/mol. Its IUPAC name is 5-amino-2-[[2-[[6-amino-2-[(2-amino-4-methylsulfanylbutanoyl)amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[[6-amino-2-[(2-amino-4-methylsulfanylbutanoyl)amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 19998265 |
| Molecular Formula | C27H41N7O6S |
| Molecular Weight | 591.74 g/mol |
| Exact Mass | 591.28 |
| IUPAC Name | 5-amino-2-[[2-[[6-amino-2-[(2-amino-4-methylsulfanylbutanoyl)amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoic acid |
| SMILES | CSCCC(N)C(=O)NC(CCCCN)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C27H41N7O6S/c1-41-13-11-18(29)24(36)32-20(8-4-5-12-28)25(37)34-22(14-16-15-31-19-7-3-2-6-17(16)19)26(38)33-21(27(39)40)9-10-23(30)35/h2-3,6-7,15,18,20-22,31H,4-5,8-14,28-29H2,1H3,(H2,30,35)(H,32,36)(H,33,38)(H,34,37)(H,39,40) |
| InChIKey | FAFZRCUERVOKGH-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 235.52 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.74 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|