C25H38N6O5S2 — CID 18312076
2-[[6-amino-2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-sulfanylpropanoyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18312076) has the molecular formula C25H38N6O5S2 and a molecular weight of 566.75 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-sulfanylpropanoyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-sulfanylpropanoyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18312076 |
| Molecular Formula | C25H38N6O5S2 |
| Molecular Weight | 566.75 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-sulfanylpropanoyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CSCCC(N)C(=O)NC(CS)C(=O)NC(CCCCN)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C25H38N6O5S2/c1-38-11-9-17(27)22(32)31-21(14-37)24(34)29-19(8-4-5-10-26)23(33)30-20(25(35)36)12-15-13-28-18-7-3-2-6-16(15)18/h2-3,6-7,13,17,19-21,28,37H,4-5,8-12,14,26-27H2,1H3,(H,29,34)(H,30,33)(H,31,32)(H,35,36) |
| InChIKey | WGGTVLIMCZHFRB-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 192.43 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.75 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|