C27H42N6O5S — CID 18307447
2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylsulfanylbutanoyl]amino]-3-methylbutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18307447) has the molecular formula C27H42N6O5S and a molecular weight of 562.74 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylsulfanylbutanoyl]amino]-3-methylbutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylsulfanylbutanoyl]amino]-3-methylbutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18307447 |
| Molecular Formula | C27H42N6O5S |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylsulfanylbutanoyl]amino]-3-methylbutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CSCCC(NC(=O)C(N)CCCCN)C(=O)NC(C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O)C(C)C |
| InChI | InChI=1S/C27H42N6O5S/c1-16(2)23(33-25(35)21(11-13-39-3)31-24(34)19(29)9-6-7-12-28)26(36)32-22(27(37)38)14-17-15-30-20-10-5-4-8-18(17)20/h4-5,8,10,15-16,19,21-23,30H,6-7,9,11-14,28-29H2,1-3H3,(H,31,34)(H,32,36)(H,33,35)(H,37,38) |
| InChIKey | FZVXNRVNKTXZQJ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 192.43 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|