C23H32N6O7 — CID 18303658
4-[[2-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]amino]-3-(2,6-diaminohexanoylamino)-4-oxobutanoic acid (PubChem CID 18303658) has the molecular formula C23H32N6O7 and a molecular weight of 504.54 g/mol. Its IUPAC name is 4-[[2-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]amino]-3-(2,6-diaminohexanoylamino)-4-oxobutanoic acid.
| Compound Name | 4-[[2-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]amino]-3-(2,6-diaminohexanoylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18303658 |
| Molecular Formula | C23H32N6O7 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | 4-[[2-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]amino]-3-(2,6-diaminohexanoylamino)-4-oxobutanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(CC(=O)O)C(=O)NCC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C23H32N6O7/c24-8-4-3-6-15(25)21(33)29-17(10-20(31)32)22(34)27-12-19(30)28-18(23(35)36)9-13-11-26-16-7-2-1-5-14(13)16/h1-2,5,7,11,15,17-18,26H,3-4,6,8-10,12,24-25H2,(H,27,34)(H,28,30)(H,29,33)(H,31,32)(H,35,36) |
| InChIKey | DPRSVHIGJCJRAE-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 229.73 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|