C25H39N9O5 — CID 22651039
6-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]hexanoic acid (PubChem CID 22651039) has the molecular formula C25H39N9O5 and a molecular weight of 545.65 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 22651039 |
| Molecular Formula | C25H39N9O5 |
| Molecular Weight | 545.65 g/mol |
| Exact Mass | 545.31 |
| IUPAC Name | 6-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)CNC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C25H39N9O5/c26-10-4-3-9-19(24(38)39)33-21(35)14-32-23(37)20(12-15-13-31-18-8-2-1-6-16(15)18)34-22(36)17(27)7-5-11-30-25(28)29/h1-2,6,8,13,17,19-20,31H,3-5,7,9-12,14,26-27H2,(H,32,37)(H,33,35)(H,34,36)(H,38,39)(H4,28,29,30) |
| InChIKey | VKEOEPMYWSVJKO-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 256.83 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.65 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|