C23H33N7O6 — CID 18309185
4-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]-4-oxobutanoic acid (PubChem CID 18309185) has the molecular formula C23H33N7O6 and a molecular weight of 503.56 g/mol. Its IUPAC name is 4-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18309185 |
| Molecular Formula | C23H33N7O6 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | 4-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]-4-oxobutanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NCC(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C23H33N7O6/c24-8-4-3-6-15(25)21(33)30-17(9-13-11-27-16-7-2-1-5-14(13)16)22(34)28-12-20(32)29-18(23(35)36)10-19(26)31/h1-2,5,7,11,15,17-18,27H,3-4,6,8-10,12,24-25H2,(H2,26,31)(H,28,34)(H,29,32)(H,30,33)(H,35,36) |
| InChIKey | GIOSENKMRJQQNA-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 235.52 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|