C21H30N6O5 — CID 145454286
(2S)-6-amino-2-[[(2S)-2-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid (PubChem CID 145454286) has the molecular formula C21H30N6O5 and a molecular weight of 446.51 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 145454286 |
| Molecular Formula | C21H30N6O5 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2,4-diamino-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](N)CC(N)=O)C(=O)O |
| InChI | InChI=1S/C21H30N6O5/c22-8-4-3-7-16(21(31)32)26-20(30)17(27-19(29)14(23)10-18(24)28)9-12-11-25-15-6-2-1-5-13(12)15/h1-2,5-6,11,14,16-17,25H,3-4,7-10,22-23H2,(H2,24,28)(H,26,30)(H,27,29)(H,31,32)/t14-,16-,17-/m0/s1 |
| InChIKey | ATHZHGQSAIJHQU-XIRDDKMYSA-N |
| XLogP | -0.90 |
| TPSA | 206.42 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|