C20H29N5O4S — CID 11575708
(2S)-6-amino-2-[[(2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid (PubChem CID 11575708) has the molecular formula C20H29N5O4S and a molecular weight of 435.55 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 11575708 |
| Molecular Formula | C20H29N5O4S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](N)CS)C(=O)O |
| InChI | InChI=1S/C20H29N5O4S/c21-8-4-3-7-16(20(28)29)24-19(27)17(25-18(26)14(22)11-30)9-12-10-23-15-6-2-1-5-13(12)15/h1-2,5-6,10,14,16-17,23,30H,3-4,7-9,11,21-22H2,(H,24,27)(H,25,26)(H,28,29)/t14-,16-,17-/m0/s1 |
| InChIKey | PXEGEYISOXISDV-XIRDDKMYSA-N |
| XLogP | 0.15 |
| TPSA | 163.33 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|