C29H38N6O6S — CID 18261640
6-amino-2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid (PubChem CID 18261640) has the molecular formula C29H38N6O6S and a molecular weight of 598.73 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18261640 |
| Molecular Formula | C29H38N6O6S |
| Molecular Weight | 598.73 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C29H38N6O6S/c30-12-4-3-7-23(29(40)41)33-27(38)24(13-17-8-10-19(36)11-9-17)35-28(39)25(34-26(37)21(31)16-42)14-18-15-32-22-6-2-1-5-20(18)22/h1-2,5-6,8-11,15,21,23-25,32,36,42H,3-4,7,12-14,16,30-31H2,(H,33,38)(H,34,37)(H,35,39)(H,40,41) |
| InChIKey | WAWZOLLQIHEOEU-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 212.66 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.73 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|