C30H38N6O8 — CID 18309785
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid (PubChem CID 18309785) has the molecular formula C30H38N6O8 and a molecular weight of 610.67 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18309785 |
| Molecular Formula | C30H38N6O8 |
| Molecular Weight | 610.67 g/mol |
| Exact Mass | 610.28 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid |
| SMILES | NCCCCC(N)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C30H38N6O8/c31-12-4-3-6-21(32)27(40)34-23(13-17-8-10-19(37)11-9-17)28(41)35-24(29(42)36-25(30(43)44)15-26(38)39)14-18-16-33-22-7-2-1-5-20(18)22/h1-2,5,7-11,16,21,23-25,33,37H,3-4,6,12-15,31-32H2,(H,34,40)(H,35,41)(H,36,42)(H,38,39)(H,43,44) |
| InChIKey | KTGDWRQRSLCNGZ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 249.96 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.67 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|