C29H38N6O7 — CID 18744270
6-amino-2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid (PubChem CID 18744270) has the molecular formula C29H38N6O7 and a molecular weight of 582.66 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18744270 |
| Molecular Formula | C29H38N6O7 |
| Molecular Weight | 582.66 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CO)C(=O)O |
| InChI | InChI=1S/C29H38N6O7/c30-12-4-3-7-23(29(41)42)33-27(39)24(13-17-8-10-19(37)11-9-17)35-28(40)25(34-26(38)21(31)16-36)14-18-15-32-22-6-2-1-5-20(18)22/h1-2,5-6,8-11,15,21,23-25,32,36-37H,3-4,7,12-14,16,30-31H2,(H,33,39)(H,34,38)(H,35,40)(H,41,42) |
| InChIKey | NJBWDYHQBAKVOU-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 232.89 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.66 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|