C32H44N6O6 — CID 18301768
2-[[6-amino-2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18301768) has the molecular formula C32H44N6O6 and a molecular weight of 608.74 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18301768 |
| Molecular Formula | C32H44N6O6 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.33 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC(C)CC(N)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CCCCN)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C32H44N6O6/c1-19(2)15-24(34)29(40)37-27(16-20-10-12-22(39)13-11-20)31(42)36-26(9-5-6-14-33)30(41)38-28(32(43)44)17-21-18-35-25-8-4-3-7-23(21)25/h3-4,7-8,10-13,18-19,24,26-28,35,39H,5-6,9,14-17,33-34H2,1-2H3,(H,36,42)(H,37,40)(H,38,41)(H,43,44) |
| InChIKey | KRQKLHYWGRRZRV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 212.66 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|