C31H40N6O8 — CID 22699612
4-amino-5-[[1-[[6-amino-1-[[1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-1-oxohexan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 22699612) has the molecular formula C31H40N6O8 and a molecular weight of 624.70 g/mol. Its IUPAC name is 4-amino-5-[[1-[[6-amino-1-[[1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-1-oxohexan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-amino-5-[[1-[[6-amino-1-[[1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-1-oxohexan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 22699612 |
| Molecular Formula | C31H40N6O8 |
| Molecular Weight | 624.70 g/mol |
| Exact Mass | 624.29 |
| IUPAC Name | 4-amino-5-[[1-[[6-amino-1-[[1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-1-oxohexan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CCC(=O)O)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C31H40N6O8/c32-14-4-3-7-24(29(42)37-26(31(44)45)15-18-8-10-20(38)11-9-18)35-30(43)25(36-28(41)22(33)12-13-27(39)40)16-19-17-34-23-6-2-1-5-21(19)23/h1-2,5-6,8-11,17,22,24-26,34,38H,3-4,7,12-16,32-33H2,(H,35,43)(H,36,41)(H,37,42)(H,39,40)(H,44,45) |
| InChIKey | VGSNSMPNLBSBHF-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 249.96 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.70 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|