C28H36N6O6 — CID 18491805
6-amino-2-[[2-[[2-[(2-aminoacetyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid (PubChem CID 18491805) has the molecular formula C28H36N6O6 and a molecular weight of 552.63 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2-aminoacetyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2-aminoacetyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18491805 |
| Molecular Formula | C28H36N6O6 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2-aminoacetyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)CN)C(=O)O |
| InChI | InChI=1S/C28H36N6O6/c29-12-4-3-7-22(28(39)40)33-26(37)23(13-17-8-10-19(35)11-9-17)34-27(38)24(32-25(36)15-30)14-18-16-31-21-6-2-1-5-20(18)21/h1-2,5-6,8-11,16,22-24,31,35H,3-4,7,12-15,29-30H2,(H,32,36)(H,33,37)(H,34,38)(H,39,40) |
| InChIKey | SSVGDMUFWRVXJU-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 212.66 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|