C29H38N6O5S — CID 18260023
6-amino-2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid (PubChem CID 18260023) has the molecular formula C29H38N6O5S and a molecular weight of 582.73 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18260023 |
| Molecular Formula | C29H38N6O5S |
| Molecular Weight | 582.73 g/mol |
| Exact Mass | 582.26 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(Cc1ccccc1)NC(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C29H38N6O5S/c30-13-7-6-12-23(29(39)40)33-28(38)25(15-19-16-32-22-11-5-4-10-20(19)22)35-27(37)24(34-26(36)21(31)17-41)14-18-8-2-1-3-9-18/h1-5,8-11,16,21,23-25,32,41H,6-7,12-15,17,30-31H2,(H,33,38)(H,34,36)(H,35,37)(H,39,40) |
| InChIKey | VXTOCHQEKHULLP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 192.43 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.73 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|