C35H42N6O5 — CID 19947458
2-[[6-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid (PubChem CID 19947458) has the molecular formula C35H42N6O5 and a molecular weight of 626.76 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 19947458 |
| Molecular Formula | C35H42N6O5 |
| Molecular Weight | 626.76 g/mol |
| Exact Mass | 626.32 |
| IUPAC Name | 2-[[6-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1ccccc1)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C35H42N6O5/c36-18-10-9-17-29(33(43)41-31(35(45)46)20-24-13-5-2-6-14-24)39-34(44)30(19-23-11-3-1-4-12-23)40-32(42)27(37)21-25-22-38-28-16-8-7-15-26(25)28/h1-8,11-16,22,27,29-31,38H,9-10,17-21,36-37H2,(H,39,44)(H,40,42)(H,41,43)(H,45,46) |
| InChIKey | RTNWFPFEGAXROP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 192.43 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.76 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|