C24H35N7O6S — CID 18261492
4-amino-2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-4-oxobutanoic acid (PubChem CID 18261492) has the molecular formula C24H35N7O6S and a molecular weight of 549.65 g/mol. Its IUPAC name is 4-amino-2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18261492 |
| Molecular Formula | C24H35N7O6S |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | 4-amino-2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-4-oxobutanoic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CS)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C24H35N7O6S/c25-8-4-3-7-17(22(34)31-19(24(36)37)10-20(27)32)29-23(35)18(30-21(33)15(26)12-38)9-13-11-28-16-6-2-1-5-14(13)16/h1-2,5-6,11,15,17-19,28,38H,3-4,7-10,12,25-26H2,(H2,27,32)(H,29,35)(H,30,33)(H,31,34)(H,36,37) |
| InChIKey | ASELRCURWCGBPA-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 235.52 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|