C23H31N7O7S — CID 18257223
4-amino-2-[[2-[[5-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoic acid (PubChem CID 18257223) has the molecular formula C23H31N7O7S and a molecular weight of 549.61 g/mol. Its IUPAC name is 4-amino-2-[[2-[[5-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[2-[[5-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18257223 |
| Molecular Formula | C23H31N7O7S |
| Molecular Weight | 549.61 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | 4-amino-2-[[2-[[5-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoic acid |
| SMILES | NC(=O)CCC(NC(=O)C(N)CS)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C23H31N7O7S/c24-13(10-38)20(33)28-15(5-6-18(25)31)21(34)29-16(22(35)30-17(23(36)37)8-19(26)32)7-11-9-27-14-4-2-1-3-12(11)14/h1-4,9,13,15-17,27,38H,5-8,10,24H2,(H2,25,31)(H2,26,32)(H,28,33)(H,29,34)(H,30,35)(H,36,37) |
| InChIKey | HTQWCNCGBAIWGR-UHFFFAOYSA-N |
| XLogP | -2.35 |
| TPSA | 252.59 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.61 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|