C23H30N6O8S — CID 19944527
2-[[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid (PubChem CID 19944527) has the molecular formula C23H30N6O8S and a molecular weight of 550.59 g/mol. Its IUPAC name is 2-[[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 19944527 |
| Molecular Formula | C23H30N6O8S |
| Molecular Weight | 550.59 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | 2-[[2-[[5-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid |
| SMILES | NC(=O)CCC(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CS)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H30N6O8S/c24-13(7-11-9-26-14-4-2-1-3-12(11)14)20(33)27-15(5-6-18(25)30)21(34)29-17(10-38)22(35)28-16(23(36)37)8-19(31)32/h1-4,9,13,15-17,26,38H,5-8,10,24H2,(H2,25,30)(H,27,33)(H,28,35)(H,29,34)(H,31,32)(H,36,37) |
| InChIKey | CGLBUKGOTSNTEV-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 246.80 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.59 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|