C22H28N6O8S — CID 19943708
4-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-carboxypropanoyl]amino]-4-oxobutanoic acid (PubChem CID 19943708) has the molecular formula C22H28N6O8S and a molecular weight of 536.57 g/mol. Its IUPAC name is 4-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-carboxypropanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-carboxypropanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 19943708 |
| Molecular Formula | C22H28N6O8S |
| Molecular Weight | 536.57 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | 4-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-carboxypropanoyl]amino]-4-oxobutanoic acid |
| SMILES | NC(=O)CC(NC(=O)C(CC(=O)O)NC(=O)C(CS)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C22H28N6O8S/c23-12(5-10-8-25-13-4-2-1-3-11(10)13)19(32)28-16(9-37)21(34)26-14(7-18(30)31)20(33)27-15(22(35)36)6-17(24)29/h1-4,8,12,14-16,25,37H,5-7,9,23H2,(H2,24,29)(H,26,34)(H,27,33)(H,28,32)(H,30,31)(H,35,36) |
| InChIKey | GHUWWWRQJQOKHI-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 246.80 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.57 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|